C27H26ClN3S — CID 34883299
6-(4-chlorophenyl)-2-(4-methylphenyl)-N-prop-2-enyl-1,4-diazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioamide (PubChem CID 34883299) has the molecular formula C27H26ClN3S and a molecular weight of 460.05 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-2-(4-methylphenyl)-N-prop-2-enyl-1,4-diazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioamide.
| Compound Name | 6-(4-chlorophenyl)-2-(4-methylphenyl)-N-prop-2-enyl-1,4-diazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioamide |
|---|---|
| PubChem CID | 34883299 |
| Molecular Formula | C27H26ClN3S |
| Molecular Weight | 460.05 g/mol |
| Exact Mass | 459.15 |
| IUPAC Name | 6-(4-chlorophenyl)-2-(4-methylphenyl)-N-prop-2-enyl-1,4-diazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioamide |
| SMILES | C=CCNC(=S)c1c(-c2ccc(Cl)cc2)c2c3n(c(-c4ccc(C)cc4)cn13)CCCC2 |
| InChI | InChI=1S/C27H26ClN3S/c1-3-15-29-26(32)25-24(20-11-13-21(28)14-12-20)22-6-4-5-16-30-23(17-31(25)27(22)30)19-9-7-18(2)8-10-19/h3,7-14,17H,1,4-6,15-16H2,2H3,(H,29,32) |
| InChIKey | ILWODFVOJSOAOX-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 21.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.05 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|