C13H17N3O4S — CID 3488708
methyl 5-cyano-4-(3,3-dimethyl-2-oxobutyl)-6-oxo-2-sulfanylidene-1,3-diazinane-4-carboxylate (PubChem CID 3488708) has the molecular formula C13H17N3O4S and a molecular weight of 311.36 g/mol. Its IUPAC name is methyl 5-cyano-4-(3,3-dimethyl-2-oxobutyl)-6-oxo-2-sulfanylidene-1,3-diazinane-4-carboxylate.
| Compound Name | methyl 5-cyano-4-(3,3-dimethyl-2-oxobutyl)-6-oxo-2-sulfanylidene-1,3-diazinane-4-carboxylate |
|---|---|
| PubChem CID | 3488708 |
| Molecular Formula | C13H17N3O4S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | methyl 5-cyano-4-(3,3-dimethyl-2-oxobutyl)-6-oxo-2-sulfanylidene-1,3-diazinane-4-carboxylate |
| SMILES | COC(=O)C1(CC(=O)C(C)(C)C)NC(=S)NC(=O)C1C#N |
| InChI | InChI=1S/C13H17N3O4S/c1-12(2,3)8(17)5-13(10(19)20-4)7(6-14)9(18)15-11(21)16-13/h7H,5H2,1-4H3,(H2,15,16,18,21) |
| InChIKey | UDYJSHVPJGVVTP-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 108.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|