C22H18N2O — CID 3489299
2-cyano-N-(2,5-dimethylphenyl)-3-naphthalen-1-ylprop-2-enamide (PubChem CID 3489299) has the molecular formula C22H18N2O and a molecular weight of 326.40 g/mol. Its IUPAC name is 2-cyano-N-(2,5-dimethylphenyl)-3-naphthalen-1-ylprop-2-enamide.
| Compound Name | 2-cyano-N-(2,5-dimethylphenyl)-3-naphthalen-1-ylprop-2-enamide |
|---|---|
| PubChem CID | 3489299 |
| Molecular Formula | C22H18N2O |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | 2-cyano-N-(2,5-dimethylphenyl)-3-naphthalen-1-ylprop-2-enamide |
| SMILES | Cc1ccc(C)c(NC(=O)C(C#N)=Cc2cccc3ccccc23)c1 |
| InChI | InChI=1S/C22H18N2O/c1-15-10-11-16(2)21(12-15)24-22(25)19(14-23)13-18-8-5-7-17-6-3-4-9-20(17)18/h3-13H,1-2H3,(H,24,25) |
| InChIKey | JQXCXSFSRJUTTI-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|