C15H18IN3OS — CID 3489528
2-(1-aminobutyl)-N-[(3-iodophenyl)methyl]-1,3-thiazole-4-carboxamide (PubChem CID 3489528) has the molecular formula C15H18IN3OS and a molecular weight of 415.30 g/mol. Its IUPAC name is 2-(1-aminobutyl)-N-[(3-iodophenyl)methyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(1-aminobutyl)-N-[(3-iodophenyl)methyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 3489528 |
| Molecular Formula | C15H18IN3OS |
| Molecular Weight | 415.30 g/mol |
| Exact Mass | 415.02 |
| IUPAC Name | 2-(1-aminobutyl)-N-[(3-iodophenyl)methyl]-1,3-thiazole-4-carboxamide |
| SMILES | CCCC(N)c1nc(C(=O)NCc2cccc(I)c2)cs1 |
| InChI | InChI=1S/C15H18IN3OS/c1-2-4-12(17)15-19-13(9-21-15)14(20)18-8-10-5-3-6-11(16)7-10/h3,5-7,9,12H,2,4,8,17H2,1H3,(H,18,20) |
| InChIKey | SIZILBSRVWELAW-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.30 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|