C38H58N2O5 — CID 3489531
1-[[17-(cyclohexanecarbonyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-1-(oxolan-2-ylmethyl)-3-propan-2-ylurea (PubChem CID 3489531) has the molecular formula C38H58N2O5 and a molecular weight of 622.89 g/mol. Its IUPAC name is 1-[[17-(cyclohexanecarbonyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-1-(oxolan-2-ylmethyl)-3-propan-2-ylurea.
| Compound Name | 1-[[17-(cyclohexanecarbonyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-1-(oxolan-2-ylmethyl)-3-propan-2-ylurea |
|---|---|
| PubChem CID | 3489531 |
| Molecular Formula | C38H58N2O5 |
| Molecular Weight | 622.89 g/mol |
| Exact Mass | 622.43 |
| IUPAC Name | 1-[[17-(cyclohexanecarbonyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-1-(oxolan-2-ylmethyl)-3-propan-2-ylurea |
| SMILES | CC(C)NC(=O)N(CC1CCCO1)CC1(O)CCC2C34C=CC5(C=C3C(=O)C3CCCCC3)CC(O)CCC5(C)C4CCC21C |
| InChI | InChI=1S/C38H58N2O5/c1-25(2)39-33(43)40(23-28-11-8-20-45-28)24-37(44)17-14-31-35(37,4)16-13-30-34(3)15-12-27(41)21-36(34)18-19-38(30,31)29(22-36)32(42)26-9-6-5-7-10-26/h18-19,22,25-28,30-31,41,44H,5-17,20-21,23-24H2,1-4H3,(H,39,43) |
| InChIKey | UYSZXIQGIHNRFV-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.89 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|