About chroman-4'-one-3'-spiro-3-N-methyl-4-(4-methylphenyl)-pyrrolidine-2-spiro-3"-oxindole
chroman-4'-one-3'-spiro-3-N-methyl-4-(4-methylphenyl)-pyrrolidine-2-spiro-3"-oxindole (PubChem CID 3489657) has the molecular formula C27H24N2O3
and a molecular weight of 424.50 g/mol.
Molecular Properties
| Compound Name | chroman-4'-one-3'-spiro-3-N-methyl-4-(4-methylphenyl)-pyrrolidine-2-spiro-3"-oxindole |
| PubChem CID | 3489657 |
| Molecular Formula | C27H24N2O3 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | — |
| SMILES | Cc1ccc(C2CN(C)C3(C(=O)Nc4ccccc43)C23COc2ccccc2C3=O)cc1 |
| InChI | InChI=1S/C27H24N2O3/c1-17-11-13-18(14-12-17)21-15-29(2)27(20-8-4-5-9-22(20)28-25(27)31)26(21)16-32-23-10-6-3-7-19(23)24(26)30/h3-14,21H,15-16H2,1-2H3,(H,28,31) |
| InChIKey | CYYZPJAXGZCLPS-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze chroman-4'-one-3'-spiro-3-N-methyl-4-(4-methylphenyl)-pyrrolidine-2-spiro-3"-oxindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chroman-4'-one-3'-spiro-3-N-methyl-4-(4-methylphenyl)-pyrrolidine-2-spiro-3"-oxindole?
The IUPAC name of chroman-4'-one-3'-spiro-3-N-methyl-4-(4-methylphenyl)-pyrrolidine-2-spiro-3"-oxindole (CID 3489657) is not available.
What is the SMILES notation for chroman-4'-one-3'-spiro-3-N-methyl-4-(4-methylphenyl)-pyrrolidine-2-spiro-3"-oxindole?
The canonical SMILES for chroman-4'-one-3'-spiro-3-N-methyl-4-(4-methylphenyl)-pyrrolidine-2-spiro-3"-oxindole is Cc1ccc(C2CN(C)C3(C(=O)Nc4ccccc43)C23COc2ccccc2C3=O)cc1.
What is the InChIKey of chroman-4'-one-3'-spiro-3-N-methyl-4-(4-methylphenyl)-pyrrolidine-2-spiro-3"-oxindole?
The InChIKey is CYYZPJAXGZCLPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H24N2O3/c1-17-11-13-18(14-12-17)21-15-29(2)27(20-8-4-5-9-22(20)28-25(27)31)26(21)16-32-23-10-6-3-7-19(23)24(26)30/h3-14,21H,15-16H2,1-2H3,(H,28,31).
What are the key properties of chroman-4'-one-3'-spiro-3-N-methyl-4-(4-methylphenyl)-pyrrolidine-2-spiro-3"-oxindole?
chroman-4'-one-3'-spiro-3-N-methyl-4-(4-methylphenyl)-pyrrolidine-2-spiro-3"-oxindole has a molecular weight of 424.50 g/mol, XLogP of 4.13, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for chroman-4'-one-3'-spiro-3-N-methyl-4-(4-methylphenyl)-pyrrolidine-2-spiro-3"-oxindole is sourced from PubChem (CID 3489657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).