C23H21N3O3S — CID 3489720
[4-(11-methyl-3-oxo-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-dien-5-yl)phenyl] benzoate (PubChem CID 3489720) has the molecular formula C23H21N3O3S and a molecular weight of 419.51 g/mol. Its IUPAC name is [4-(11-methyl-3-oxo-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-dien-5-yl)phenyl] benzoate.
| Compound Name | [4-(11-methyl-3-oxo-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-dien-5-yl)phenyl] benzoate |
|---|---|
| PubChem CID | 3489720 |
| Molecular Formula | C23H21N3O3S |
| Molecular Weight | 419.51 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | [4-(11-methyl-3-oxo-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-dien-5-yl)phenyl] benzoate |
| SMILES | CN1CCc2c(sc3c2C(=O)NC(c2ccc(OC(=O)c4ccccc4)cc2)N3)C1 |
| InChI | InChI=1S/C23H21N3O3S/c1-26-12-11-17-18(13-26)30-22-19(17)21(27)24-20(25-22)14-7-9-16(10-8-14)29-23(28)15-5-3-2-4-6-15/h2-10,20,25H,11-13H2,1H3,(H,24,27) |
| InChIKey | XIXPDNXVGNKHLQ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.51 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|