C27H28BrN3O3 — CID 3490027
N-[1-[4-[(5-bromo-2-hydroxyphenyl)methylideneamino]phenyl]ethylideneamino]-2-(5-methyl-2-propan-2-ylphenoxy)acetamide (PubChem CID 3490027) has the molecular formula C27H28BrN3O3 and a molecular weight of 522.44 g/mol. Its IUPAC name is N-[1-[4-[(5-bromo-2-hydroxyphenyl)methylideneamino]phenyl]ethylideneamino]-2-(5-methyl-2-propan-2-ylphenoxy)acetamide.
| Compound Name | N-[1-[4-[(5-bromo-2-hydroxyphenyl)methylideneamino]phenyl]ethylideneamino]-2-(5-methyl-2-propan-2-ylphenoxy)acetamide |
|---|---|
| PubChem CID | 3490027 |
| Molecular Formula | C27H28BrN3O3 |
| Molecular Weight | 522.44 g/mol |
| Exact Mass | 521.13 |
| IUPAC Name | N-[1-[4-[(5-bromo-2-hydroxyphenyl)methylideneamino]phenyl]ethylideneamino]-2-(5-methyl-2-propan-2-ylphenoxy)acetamide |
| SMILES | CC(=NNC(=O)COc1cc(C)ccc1C(C)C)c1ccc(/N=C/c2cc(Br)ccc2O)cc1 |
| InChI | InChI=1S/C27H28BrN3O3/c1-17(2)24-11-5-18(3)13-26(24)34-16-27(33)31-30-19(4)20-6-9-23(10-7-20)29-15-21-14-22(28)8-12-25(21)32/h5-15,17,32H,16H2,1-4H3,(H,31,33)/b29-15+,30-19? |
| InChIKey | LYYYHXRIUCKPIG-QNKJSQCDSA-N |
| XLogP | 6.26 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.44 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|