C7H11Cl3N2OS2 — CID 3490047
(1-acetamido-2,2,2-trichloroethyl) N,N-dimethylcarbamodithioate (PubChem CID 3490047) has the molecular formula C7H11Cl3N2OS2 and a molecular weight of 309.67 g/mol. Its IUPAC name is (1-acetamido-2,2,2-trichloroethyl) N,N-dimethylcarbamodithioate.
| Compound Name | (1-acetamido-2,2,2-trichloroethyl) N,N-dimethylcarbamodithioate |
|---|---|
| PubChem CID | 3490047 |
| Molecular Formula | C7H11Cl3N2OS2 |
| Molecular Weight | 309.67 g/mol |
| Exact Mass | 307.94 |
| IUPAC Name | (1-acetamido-2,2,2-trichloroethyl) N,N-dimethylcarbamodithioate |
| SMILES | CC(=O)NC(SC(=S)N(C)C)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C7H11Cl3N2OS2/c1-4(13)11-5(7(8,9)10)15-6(14)12(2)3/h5H,1-3H3,(H,11,13) |
| InChIKey | DFTATZQBDBNHLQ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.67 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|