About (2-anilino-2-oxoethyl) 2,2-dichloro-1-methylcyclopropane-1-carboxylate
(2-anilino-2-oxoethyl) 2,2-dichloro-1-methylcyclopropane-1-carboxylate (PubChem CID 3490954) has the molecular formula C13H13Cl2NO3
and a molecular weight of 302.16 g/mol. Its IUPAC name is (2-anilino-2-oxoethyl) 2,2-dichloro-1-methylcyclopropane-1-carboxylate.
Molecular Properties
| Compound Name | (2-anilino-2-oxoethyl) 2,2-dichloro-1-methylcyclopropane-1-carboxylate |
| PubChem CID | 3490954 |
| Molecular Formula | C13H13Cl2NO3 |
| Molecular Weight | 302.16 g/mol |
| Exact Mass | 301.03 |
| IUPAC Name | (2-anilino-2-oxoethyl) 2,2-dichloro-1-methylcyclopropane-1-carboxylate |
| SMILES | CC1(C(=O)OCC(=O)Nc2ccccc2)CC1(Cl)Cl |
| InChI | InChI=1S/C13H13Cl2NO3/c1-12(8-13(12,14)15)11(18)19-7-10(17)16-9-5-3-2-4-6-9/h2-6H,7-8H2,1H3,(H,16,17) |
| InChIKey | PQWUIQVMMQXYIH-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.16 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (2-anilino-2-oxoethyl) 2,2-dichloro-1-methylcyclopropane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-anilino-2-oxoethyl) 2,2-dichloro-1-methylcyclopropane-1-carboxylate?
The IUPAC name of (2-anilino-2-oxoethyl) 2,2-dichloro-1-methylcyclopropane-1-carboxylate (CID 3490954) is (2-anilino-2-oxoethyl) 2,2-dichloro-1-methylcyclopropane-1-carboxylate.
What is the SMILES notation for (2-anilino-2-oxoethyl) 2,2-dichloro-1-methylcyclopropane-1-carboxylate?
The canonical SMILES for (2-anilino-2-oxoethyl) 2,2-dichloro-1-methylcyclopropane-1-carboxylate is CC1(C(=O)OCC(=O)Nc2ccccc2)CC1(Cl)Cl.
What is the InChIKey of (2-anilino-2-oxoethyl) 2,2-dichloro-1-methylcyclopropane-1-carboxylate?
The InChIKey is PQWUIQVMMQXYIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13Cl2NO3/c1-12(8-13(12,14)15)11(18)19-7-10(17)16-9-5-3-2-4-6-9/h2-6H,7-8H2,1H3,(H,16,17).
What are the key properties of (2-anilino-2-oxoethyl) 2,2-dichloro-1-methylcyclopropane-1-carboxylate?
(2-anilino-2-oxoethyl) 2,2-dichloro-1-methylcyclopropane-1-carboxylate has a molecular weight of 302.16 g/mol, XLogP of 2.75, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-anilino-2-oxoethyl) 2,2-dichloro-1-methylcyclopropane-1-carboxylate is sourced from PubChem (CID 3490954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).