C25H29F2N3OS — CID 3491359
8-(2,6-difluoro-3-methylbenzoyl)-N-(1-phenylethyl)-2,8-diazaspiro[4.5]decane-2-carbothioamide (PubChem CID 3491359) has the molecular formula C25H29F2N3OS and a molecular weight of 457.59 g/mol. Its IUPAC name is 8-(2,6-difluoro-3-methylbenzoyl)-N-(1-phenylethyl)-2,8-diazaspiro[4.5]decane-2-carbothioamide.
| Compound Name | 8-(2,6-difluoro-3-methylbenzoyl)-N-(1-phenylethyl)-2,8-diazaspiro[4.5]decane-2-carbothioamide |
|---|---|
| PubChem CID | 3491359 |
| Molecular Formula | C25H29F2N3OS |
| Molecular Weight | 457.59 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | 8-(2,6-difluoro-3-methylbenzoyl)-N-(1-phenylethyl)-2,8-diazaspiro[4.5]decane-2-carbothioamide |
| SMILES | Cc1ccc(F)c(C(=O)N2CCC3(CC2)CCN(C(=S)NC(C)c2ccccc2)C3)c1F |
| InChI | InChI=1S/C25H29F2N3OS/c1-17-8-9-20(26)21(22(17)27)23(31)29-13-10-25(11-14-29)12-15-30(16-25)24(32)28-18(2)19-6-4-3-5-7-19/h3-9,18H,10-16H2,1-2H3,(H,28,32) |
| InChIKey | CVIPECXKEBRPTH-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.59 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|