About 3-chloro-N-[(2,5-dimethoxy-2H-furan-5-yl)methyl]-4-fluorobenzenesulfonamide
3-chloro-N-[(2,5-dimethoxy-2H-furan-5-yl)methyl]-4-fluorobenzenesulfonamide (PubChem CID 3491810) has the molecular formula C13H15ClFNO5S
and a molecular weight of 351.78 g/mol. Its IUPAC name is 3-chloro-N-[(2,5-dimethoxy-2H-furan-5-yl)methyl]-4-fluorobenzenesulfonamide.
Molecular Properties
| Compound Name | 3-chloro-N-[(2,5-dimethoxy-2H-furan-5-yl)methyl]-4-fluorobenzenesulfonamide |
| PubChem CID | 3491810 |
| Molecular Formula | C13H15ClFNO5S |
| Molecular Weight | 351.78 g/mol |
| Exact Mass | 351.03 |
| IUPAC Name | 3-chloro-N-[(2,5-dimethoxy-2H-furan-5-yl)methyl]-4-fluorobenzenesulfonamide |
| SMILES | COC1C=CC(CNS(=O)(=O)c2ccc(F)c(Cl)c2)(OC)O1 |
| InChI | InChI=1S/C13H15ClFNO5S/c1-19-12-5-6-13(20-2,21-12)8-16-22(17,18)9-3-4-11(15)10(14)7-9/h3-7,12,16H,8H2,1-2H3 |
| InChIKey | IUUVDANLMRFYKD-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.78 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_misc_A(5)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-N-[(2,5-dimethoxy-2H-furan-5-yl)methyl]-4-fluorobenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-N-[(2,5-dimethoxy-2H-furan-5-yl)methyl]-4-fluorobenzenesulfonamide?
The IUPAC name of 3-chloro-N-[(2,5-dimethoxy-2H-furan-5-yl)methyl]-4-fluorobenzenesulfonamide (CID 3491810) is 3-chloro-N-[(2,5-dimethoxy-2H-furan-5-yl)methyl]-4-fluorobenzenesulfonamide.
What is the SMILES notation for 3-chloro-N-[(2,5-dimethoxy-2H-furan-5-yl)methyl]-4-fluorobenzenesulfonamide?
The canonical SMILES for 3-chloro-N-[(2,5-dimethoxy-2H-furan-5-yl)methyl]-4-fluorobenzenesulfonamide is COC1C=CC(CNS(=O)(=O)c2ccc(F)c(Cl)c2)(OC)O1.
What is the InChIKey of 3-chloro-N-[(2,5-dimethoxy-2H-furan-5-yl)methyl]-4-fluorobenzenesulfonamide?
The InChIKey is IUUVDANLMRFYKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15ClFNO5S/c1-19-12-5-6-13(20-2,21-12)8-16-22(17,18)9-3-4-11(15)10(14)7-9/h3-7,12,16H,8H2,1-2H3.
What are the key properties of 3-chloro-N-[(2,5-dimethoxy-2H-furan-5-yl)methyl]-4-fluorobenzenesulfonamide?
3-chloro-N-[(2,5-dimethoxy-2H-furan-5-yl)methyl]-4-fluorobenzenesulfonamide has a molecular weight of 351.78 g/mol, XLogP of 1.66, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-N-[(2,5-dimethoxy-2H-furan-5-yl)methyl]-4-fluorobenzenesulfonamide is sourced from PubChem (CID 3491810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).