C20H20N4O4S — CID 3492181
3,6-bis(3,4-dimethoxyphenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine (PubChem CID 3492181) has the molecular formula C20H20N4O4S and a molecular weight of 412.47 g/mol. Its IUPAC name is 3,6-bis(3,4-dimethoxyphenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine.
| Compound Name | 3,6-bis(3,4-dimethoxyphenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine |
|---|---|
| PubChem CID | 3492181 |
| Molecular Formula | C20H20N4O4S |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | 3,6-bis(3,4-dimethoxyphenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine |
| SMILES | COc1ccc(C2=Nn3c(nnc3-c3ccc(OC)c(OC)c3)SC2)cc1OC |
| InChI | InChI=1S/C20H20N4O4S/c1-25-15-7-5-12(9-17(15)27-3)14-11-29-20-22-21-19(24(20)23-14)13-6-8-16(26-2)18(10-13)28-4/h5-10H,11H2,1-4H3 |
| InChIKey | MRORVGVWPLDEFD-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 79.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |