C13H13NO2 — CID 3492257
2-methyl-2,3,4,6-tetrahydropyrano[3,2-c]quinolin-5-one (PubChem CID 3492257) has the molecular formula C13H13NO2 and a molecular weight of 215.25 g/mol. Its IUPAC name is 2-methyl-2,3,4,6-tetrahydropyrano[3,2-c]quinolin-5-one.
| Compound Name | 2-methyl-2,3,4,6-tetrahydropyrano[3,2-c]quinolin-5-one |
|---|---|
| PubChem CID | 3492257 |
| Molecular Formula | C13H13NO2 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | 2-methyl-2,3,4,6-tetrahydropyrano[3,2-c]quinolin-5-one |
| SMILES | CC1CCc2c(c3ccccc3[nH]c2=O)O1 |
| InChI | InChI=1S/C13H13NO2/c1-8-6-7-10-12(16-8)9-4-2-3-5-11(9)14-13(10)15/h2-5,8H,6-7H2,1H3,(H,14,15) |
| InChIKey | GOUGXEZJGPPHNS-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |