About 1,3-bis(4-methylphenyl)-1,3-diazetidine-2,4-dione
1,3-bis(4-methylphenyl)-1,3-diazetidine-2,4-dione (PubChem CID 3492365) has the molecular formula C16H14N2O2
and a molecular weight of 266.30 g/mol. Its IUPAC name is 1,3-bis(4-methylphenyl)-1,3-diazetidine-2,4-dione.
Molecular Properties
| Compound Name | 1,3-bis(4-methylphenyl)-1,3-diazetidine-2,4-dione |
| PubChem CID | 3492365 |
| Molecular Formula | C16H14N2O2 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 1,3-bis(4-methylphenyl)-1,3-diazetidine-2,4-dione |
| SMILES | Cc1ccc(N2C(=O)N(c3ccc(C)cc3)C2=O)cc1 |
| InChI | InChI=1S/C16H14N2O2/c1-11-3-7-13(8-4-11)17-15(19)18(16(17)20)14-9-5-12(2)6-10-14/h3-10H,1-2H3 |
| InChIKey | AZZFGWWOGRBVOV-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,3-bis(4-methylphenyl)-1,3-diazetidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-bis(4-methylphenyl)-1,3-diazetidine-2,4-dione?
The IUPAC name of 1,3-bis(4-methylphenyl)-1,3-diazetidine-2,4-dione (CID 3492365) is 1,3-bis(4-methylphenyl)-1,3-diazetidine-2,4-dione.
What is the SMILES notation for 1,3-bis(4-methylphenyl)-1,3-diazetidine-2,4-dione?
The canonical SMILES for 1,3-bis(4-methylphenyl)-1,3-diazetidine-2,4-dione is Cc1ccc(N2C(=O)N(c3ccc(C)cc3)C2=O)cc1.
What is the InChIKey of 1,3-bis(4-methylphenyl)-1,3-diazetidine-2,4-dione?
The InChIKey is AZZFGWWOGRBVOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N2O2/c1-11-3-7-13(8-4-11)17-15(19)18(16(17)20)14-9-5-12(2)6-10-14/h3-10H,1-2H3.
What are the key properties of 1,3-bis(4-methylphenyl)-1,3-diazetidine-2,4-dione?
1,3-bis(4-methylphenyl)-1,3-diazetidine-2,4-dione has a molecular weight of 266.30 g/mol, XLogP of 3.87, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-bis(4-methylphenyl)-1,3-diazetidine-2,4-dione is sourced from PubChem (CID 3492365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).