About (4Z)-4-(3-methyl-1,3-benzothiazol-2-ylidene)-2-(4-methylphenyl)-1,3-oxazol-5-one
(4Z)-4-(3-methyl-1,3-benzothiazol-2-ylidene)-2-(4-methylphenyl)-1,3-oxazol-5-one (PubChem CID 34924427) has the molecular formula C18H14N2O2S
and a molecular weight of 322.39 g/mol. Its IUPAC name is (4Z)-4-(3-methyl-1,3-benzothiazol-2-ylidene)-2-(4-methylphenyl)-1,3-oxazol-5-one.
Molecular Properties
| Compound Name | (4Z)-4-(3-methyl-1,3-benzothiazol-2-ylidene)-2-(4-methylphenyl)-1,3-oxazol-5-one |
| PubChem CID | 34924427 |
| Molecular Formula | C18H14N2O2S |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | (4Z)-4-(3-methyl-1,3-benzothiazol-2-ylidene)-2-(4-methylphenyl)-1,3-oxazol-5-one |
| SMILES | Cc1ccc(C2=N/C(=C3\Sc4ccccc4N3C)C(=O)O2)cc1 |
| InChI | InChI=1S/C18H14N2O2S/c1-11-7-9-12(10-8-11)16-19-15(18(21)22-16)17-20(2)13-5-3-4-6-14(13)23-17/h3-10H,1-2H3/b17-15- |
| InChIKey | MEISOAUGIHDRGK-ICFOKQHNSA-N |
| XLogP | 3.71 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (4Z)-4-(3-methyl-1,3-benzothiazol-2-ylidene)-2-(4-methylphenyl)-1,3-oxazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-4-(3-methyl-1,3-benzothiazol-2-ylidene)-2-(4-methylphenyl)-1,3-oxazol-5-one?
The IUPAC name of (4Z)-4-(3-methyl-1,3-benzothiazol-2-ylidene)-2-(4-methylphenyl)-1,3-oxazol-5-one (CID 34924427) is (4Z)-4-(3-methyl-1,3-benzothiazol-2-ylidene)-2-(4-methylphenyl)-1,3-oxazol-5-one.
What is the SMILES notation for (4Z)-4-(3-methyl-1,3-benzothiazol-2-ylidene)-2-(4-methylphenyl)-1,3-oxazol-5-one?
The canonical SMILES for (4Z)-4-(3-methyl-1,3-benzothiazol-2-ylidene)-2-(4-methylphenyl)-1,3-oxazol-5-one is Cc1ccc(C2=N/C(=C3\Sc4ccccc4N3C)C(=O)O2)cc1.
What is the InChIKey of (4Z)-4-(3-methyl-1,3-benzothiazol-2-ylidene)-2-(4-methylphenyl)-1,3-oxazol-5-one?
The InChIKey is MEISOAUGIHDRGK-ICFOKQHNSA-N. The full InChI is InChI=1S/C18H14N2O2S/c1-11-7-9-12(10-8-11)16-19-15(18(21)22-16)17-20(2)13-5-3-4-6-14(13)23-17/h3-10H,1-2H3/b17-15-.
What are the key properties of (4Z)-4-(3-methyl-1,3-benzothiazol-2-ylidene)-2-(4-methylphenyl)-1,3-oxazol-5-one?
(4Z)-4-(3-methyl-1,3-benzothiazol-2-ylidene)-2-(4-methylphenyl)-1,3-oxazol-5-one has a molecular weight of 322.39 g/mol, XLogP of 3.71, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-4-(3-methyl-1,3-benzothiazol-2-ylidene)-2-(4-methylphenyl)-1,3-oxazol-5-one is sourced from PubChem (CID 34924427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).