About 5-[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]-2-ethyl-1,3-oxazole-4-carbonitrile
5-[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]-2-ethyl-1,3-oxazole-4-carbonitrile (PubChem CID 34925239) has the molecular formula C18H18N4OS
and a molecular weight of 338.44 g/mol. Its IUPAC name is 5-[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]-2-ethyl-1,3-oxazole-4-carbonitrile.
Molecular Properties
| Compound Name | 5-[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]-2-ethyl-1,3-oxazole-4-carbonitrile |
| PubChem CID | 34925239 |
| Molecular Formula | C18H18N4OS |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 5-[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]-2-ethyl-1,3-oxazole-4-carbonitrile |
| SMILES | CCc1nc(C#N)c(N2CCC(c3nc4ccccc4s3)CC2)o1 |
| InChI | InChI=1S/C18H18N4OS/c1-2-16-20-14(11-19)18(23-16)22-9-7-12(8-10-22)17-21-13-5-3-4-6-15(13)24-17/h3-6,12H,2,7-10H2,1H3 |
| InChIKey | ASSFKFFADOXDEG-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 65.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]-2-ethyl-1,3-oxazole-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]-2-ethyl-1,3-oxazole-4-carbonitrile?
The IUPAC name of 5-[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]-2-ethyl-1,3-oxazole-4-carbonitrile (CID 34925239) is 5-[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]-2-ethyl-1,3-oxazole-4-carbonitrile.
What is the SMILES notation for 5-[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]-2-ethyl-1,3-oxazole-4-carbonitrile?
The canonical SMILES for 5-[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]-2-ethyl-1,3-oxazole-4-carbonitrile is CCc1nc(C#N)c(N2CCC(c3nc4ccccc4s3)CC2)o1.
What is the InChIKey of 5-[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]-2-ethyl-1,3-oxazole-4-carbonitrile?
The InChIKey is ASSFKFFADOXDEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N4OS/c1-2-16-20-14(11-19)18(23-16)22-9-7-12(8-10-22)17-21-13-5-3-4-6-15(13)24-17/h3-6,12H,2,7-10H2,1H3.
What are the key properties of 5-[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]-2-ethyl-1,3-oxazole-4-carbonitrile?
5-[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]-2-ethyl-1,3-oxazole-4-carbonitrile has a molecular weight of 338.44 g/mol, XLogP of 4.10, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]-2-ethyl-1,3-oxazole-4-carbonitrile is sourced from PubChem (CID 34925239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).