C26H29N4O3S3+ — CID 3492766
N-[3-(1,3-benzothiazol-2-yl)-6-methyl-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-6-ium-2-yl]-4-(diethylsulfamoyl)benzamide (PubChem CID 3492766) has the molecular formula C26H29N4O3S3+ and a molecular weight of 541.74 g/mol. Its IUPAC name is N-[3-(1,3-benzothiazol-2-yl)-6-methyl-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-6-ium-2-yl]-4-(diethylsulfamoyl)benzamide.
| Compound Name | N-[3-(1,3-benzothiazol-2-yl)-6-methyl-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-6-ium-2-yl]-4-(diethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 3492766 |
| Molecular Formula | C26H29N4O3S3+ |
| Molecular Weight | 541.74 g/mol |
| Exact Mass | 541.14 |
| IUPAC Name | N-[3-(1,3-benzothiazol-2-yl)-6-methyl-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-6-ium-2-yl]-4-(diethylsulfamoyl)benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C(=O)Nc2sc3c(c2-c2nc4ccccc4s2)CC[NH+](C)C3)cc1 |
| InChI | InChI=1S/C26H28N4O3S3/c1-4-30(5-2)36(32,33)18-12-10-17(11-13-18)24(31)28-26-23(19-14-15-29(3)16-22(19)35-26)25-27-20-8-6-7-9-21(20)34-25/h6-13H,4-5,14-16H2,1-3H3,(H,28,31)/p+1 |
| InChIKey | XTNPTCYECQYVTN-UHFFFAOYSA-O |
| XLogP | 3.88 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.74 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |