About 1-propan-2-yl-4,5,6,7-tetrahydrobenzotriazole
1-propan-2-yl-4,5,6,7-tetrahydrobenzotriazole (PubChem CID 3493727) has the molecular formula C9H15N3
and a molecular weight of 165.24 g/mol. Its IUPAC name is 1-propan-2-yl-4,5,6,7-tetrahydrobenzotriazole.
Molecular Properties
| Compound Name | 1-propan-2-yl-4,5,6,7-tetrahydrobenzotriazole |
| PubChem CID | 3493727 |
| Molecular Formula | C9H15N3 |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | 1-propan-2-yl-4,5,6,7-tetrahydrobenzotriazole |
| SMILES | CC(C)n1nnc2c1CCCC2 |
| InChI | InChI=1S/C9H15N3/c1-7(2)12-9-6-4-3-5-8(9)10-11-12/h7H,3-6H2,1-2H3 |
| InChIKey | XCWCZUAMPTVTAQ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-propan-2-yl-4,5,6,7-tetrahydrobenzotriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-propan-2-yl-4,5,6,7-tetrahydrobenzotriazole?
The IUPAC name of 1-propan-2-yl-4,5,6,7-tetrahydrobenzotriazole (CID 3493727) is 1-propan-2-yl-4,5,6,7-tetrahydrobenzotriazole.
What is the SMILES notation for 1-propan-2-yl-4,5,6,7-tetrahydrobenzotriazole?
The canonical SMILES for 1-propan-2-yl-4,5,6,7-tetrahydrobenzotriazole is CC(C)n1nnc2c1CCCC2.
What is the InChIKey of 1-propan-2-yl-4,5,6,7-tetrahydrobenzotriazole?
The InChIKey is XCWCZUAMPTVTAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3/c1-7(2)12-9-6-4-3-5-8(9)10-11-12/h7H,3-6H2,1-2H3.
What are the key properties of 1-propan-2-yl-4,5,6,7-tetrahydrobenzotriazole?
1-propan-2-yl-4,5,6,7-tetrahydrobenzotriazole has a molecular weight of 165.24 g/mol, XLogP of 1.74, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-propan-2-yl-4,5,6,7-tetrahydrobenzotriazole is sourced from PubChem (CID 3493727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).