C27H28N2O9S — CID 3494085
dimethyl 5-[2,5-dimethyl-3-[2-[2-[(4-methylphenyl)sulfonylamino]acetyl]oxyacetyl]pyrrol-1-yl]benzene-1,3-dicarboxylate (PubChem CID 3494085) has the molecular formula C27H28N2O9S and a molecular weight of 556.59 g/mol. Its IUPAC name is dimethyl 5-[2,5-dimethyl-3-[2-[2-[(4-methylphenyl)sulfonylamino]acetyl]oxyacetyl]pyrrol-1-yl]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[2,5-dimethyl-3-[2-[2-[(4-methylphenyl)sulfonylamino]acetyl]oxyacetyl]pyrrol-1-yl]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 3494085 |
| Molecular Formula | C27H28N2O9S |
| Molecular Weight | 556.59 g/mol |
| Exact Mass | 556.15 |
| IUPAC Name | dimethyl 5-[2,5-dimethyl-3-[2-[2-[(4-methylphenyl)sulfonylamino]acetyl]oxyacetyl]pyrrol-1-yl]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(C(=O)OC)cc(-n2c(C)cc(C(=O)COC(=O)CNS(=O)(=O)c3ccc(C)cc3)c2C)c1 |
| InChI | InChI=1S/C27H28N2O9S/c1-16-6-8-22(9-7-16)39(34,35)28-14-25(31)38-15-24(30)23-10-17(2)29(18(23)3)21-12-19(26(32)36-4)11-20(13-21)27(33)37-5/h6-13,28H,14-15H2,1-5H3 |
| InChIKey | HLXANGSSDKCQJV-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 147.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.59 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|