About 2-(3-methoxyphenyl)-4,5-diphenyl-1H-imidazole
2-(3-methoxyphenyl)-4,5-diphenyl-1H-imidazole (PubChem CID 3494148) has the molecular formula C22H18N2O
and a molecular weight of 326.40 g/mol. Its IUPAC name is 2-(3-methoxyphenyl)-4,5-diphenyl-1H-imidazole.
Molecular Properties
| Compound Name | 2-(3-methoxyphenyl)-4,5-diphenyl-1H-imidazole |
| PubChem CID | 3494148 |
| Molecular Formula | C22H18N2O |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | 2-(3-methoxyphenyl)-4,5-diphenyl-1H-imidazole |
| SMILES | COc1cccc(-c2nc(-c3ccccc3)c(-c3ccccc3)[nH]2)c1 |
| InChI | InChI=1S/C22H18N2O/c1-25-19-14-8-13-18(15-19)22-23-20(16-9-4-2-5-10-16)21(24-22)17-11-6-3-7-12-17/h2-15H,1H3,(H,23,24) |
| InChIKey | TYLAVIXBTRSOMX-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-methoxyphenyl)-4,5-diphenyl-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-methoxyphenyl)-4,5-diphenyl-1H-imidazole?
The IUPAC name of 2-(3-methoxyphenyl)-4,5-diphenyl-1H-imidazole (CID 3494148) is 2-(3-methoxyphenyl)-4,5-diphenyl-1H-imidazole.
What is the SMILES notation for 2-(3-methoxyphenyl)-4,5-diphenyl-1H-imidazole?
The canonical SMILES for 2-(3-methoxyphenyl)-4,5-diphenyl-1H-imidazole is COc1cccc(-c2nc(-c3ccccc3)c(-c3ccccc3)[nH]2)c1.
What is the InChIKey of 2-(3-methoxyphenyl)-4,5-diphenyl-1H-imidazole?
The InChIKey is TYLAVIXBTRSOMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18N2O/c1-25-19-14-8-13-18(15-19)22-23-20(16-9-4-2-5-10-16)21(24-22)17-11-6-3-7-12-17/h2-15H,1H3,(H,23,24).
What are the key properties of 2-(3-methoxyphenyl)-4,5-diphenyl-1H-imidazole?
2-(3-methoxyphenyl)-4,5-diphenyl-1H-imidazole has a molecular weight of 326.40 g/mol, XLogP of 5.42, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-methoxyphenyl)-4,5-diphenyl-1H-imidazole is sourced from PubChem (CID 3494148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).