About N-[2,2-dimethyl-3-(3-methylbutanoylamino)propyl]-3-methylbutanamide
N-[2,2-dimethyl-3-(3-methylbutanoylamino)propyl]-3-methylbutanamide (PubChem CID 3494465) has the molecular formula C15H30N2O2
and a molecular weight of 270.42 g/mol. Its IUPAC name is N-[2,2-dimethyl-3-(3-methylbutanoylamino)propyl]-3-methylbutanamide.
Molecular Properties
| Compound Name | N-[2,2-dimethyl-3-(3-methylbutanoylamino)propyl]-3-methylbutanamide |
| PubChem CID | 3494465 |
| Molecular Formula | C15H30N2O2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.23 |
| IUPAC Name | N-[2,2-dimethyl-3-(3-methylbutanoylamino)propyl]-3-methylbutanamide |
| SMILES | CC(C)CC(=O)NCC(C)(C)CNC(=O)CC(C)C |
| InChI | InChI=1S/C15H30N2O2/c1-11(2)7-13(18)16-9-15(5,6)10-17-14(19)8-12(3)4/h11-12H,7-10H2,1-6H3,(H,16,18)(H,17,19) |
| InChIKey | LSNBRAQAMOMYLP-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[2,2-dimethyl-3-(3-methylbutanoylamino)propyl]-3-methylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2,2-dimethyl-3-(3-methylbutanoylamino)propyl]-3-methylbutanamide?
The IUPAC name of N-[2,2-dimethyl-3-(3-methylbutanoylamino)propyl]-3-methylbutanamide (CID 3494465) is N-[2,2-dimethyl-3-(3-methylbutanoylamino)propyl]-3-methylbutanamide.
What is the SMILES notation for N-[2,2-dimethyl-3-(3-methylbutanoylamino)propyl]-3-methylbutanamide?
The canonical SMILES for N-[2,2-dimethyl-3-(3-methylbutanoylamino)propyl]-3-methylbutanamide is CC(C)CC(=O)NCC(C)(C)CNC(=O)CC(C)C.
What is the InChIKey of N-[2,2-dimethyl-3-(3-methylbutanoylamino)propyl]-3-methylbutanamide?
The InChIKey is LSNBRAQAMOMYLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30N2O2/c1-11(2)7-13(18)16-9-15(5,6)10-17-14(19)8-12(3)4/h11-12H,7-10H2,1-6H3,(H,16,18)(H,17,19).
What are the key properties of N-[2,2-dimethyl-3-(3-methylbutanoylamino)propyl]-3-methylbutanamide?
N-[2,2-dimethyl-3-(3-methylbutanoylamino)propyl]-3-methylbutanamide has a molecular weight of 270.42 g/mol, XLogP of 2.34, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2,2-dimethyl-3-(3-methylbutanoylamino)propyl]-3-methylbutanamide is sourced from PubChem (CID 3494465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).