C14H14ClFN2O2S — CID 34946052
3-[(2-chloro-4-fluorophenyl)methylsulfanyl]-N-(5-methyl-1,2-oxazol-3-yl)propanamide (PubChem CID 34946052) has the molecular formula C14H14ClFN2O2S and a molecular weight of 328.80 g/mol. Its IUPAC name is 3-[(2-chloro-4-fluorophenyl)methylsulfanyl]-N-(5-methyl-1,2-oxazol-3-yl)propanamide.
| Compound Name | 3-[(2-chloro-4-fluorophenyl)methylsulfanyl]-N-(5-methyl-1,2-oxazol-3-yl)propanamide |
|---|---|
| PubChem CID | 34946052 |
| Molecular Formula | C14H14ClFN2O2S |
| Molecular Weight | 328.80 g/mol |
| Exact Mass | 328.04 |
| IUPAC Name | 3-[(2-chloro-4-fluorophenyl)methylsulfanyl]-N-(5-methyl-1,2-oxazol-3-yl)propanamide |
| SMILES | Cc1cc(NC(=O)CCSCc2ccc(F)cc2Cl)no1 |
| InChI | InChI=1S/C14H14ClFN2O2S/c1-9-6-13(18-20-9)17-14(19)4-5-21-8-10-2-3-11(16)7-12(10)15/h2-3,6-7H,4-5,8H2,1H3,(H,17,18,19) |
| InChIKey | MEHWHGGJGNMXOE-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.80 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|