C24H31ClN2O3 — CID 34953202
N-[(2S)-2-(azepan-1-yl)-2-(4-methoxyphenyl)ethyl]-2-(4-chloro-3-methylphenoxy)acetamide (PubChem CID 34953202) has the molecular formula C24H31ClN2O3 and a molecular weight of 430.98 g/mol. Its IUPAC name is N-[(2S)-2-(azepan-1-yl)-2-(4-methoxyphenyl)ethyl]-2-(4-chloro-3-methylphenoxy)acetamide.
| Compound Name | N-[(2S)-2-(azepan-1-yl)-2-(4-methoxyphenyl)ethyl]-2-(4-chloro-3-methylphenoxy)acetamide |
|---|---|
| PubChem CID | 34953202 |
| Molecular Formula | C24H31ClN2O3 |
| Molecular Weight | 430.98 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | N-[(2S)-2-(azepan-1-yl)-2-(4-methoxyphenyl)ethyl]-2-(4-chloro-3-methylphenoxy)acetamide |
| SMILES | COc1ccc([C@@H](CNC(=O)COc2ccc(Cl)c(C)c2)N2CCCCCC2)cc1 |
| InChI | InChI=1S/C24H31ClN2O3/c1-18-15-21(11-12-22(18)25)30-17-24(28)26-16-23(27-13-5-3-4-6-14-27)19-7-9-20(29-2)10-8-19/h7-12,15,23H,3-6,13-14,16-17H2,1-2H3,(H,26,28)/t23-/m1/s1 |
| InChIKey | VEJOUNKMZPBPSG-HSZRJFAPSA-N |
| XLogP | 4.77 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.98 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |