About 5-[(2-methyl-1H-indol-3-yl)diazenyl]benzene-1,3-dicarboxylic acid
5-[(2-methyl-1H-indol-3-yl)diazenyl]benzene-1,3-dicarboxylic acid (PubChem CID 3495525) has the molecular formula C17H13N3O4
and a molecular weight of 323.31 g/mol. Its IUPAC name is 5-[(2-methyl-1H-indol-3-yl)diazenyl]benzene-1,3-dicarboxylic acid.
Molecular Properties
| Compound Name | 5-[(2-methyl-1H-indol-3-yl)diazenyl]benzene-1,3-dicarboxylic acid |
| PubChem CID | 3495525 |
| Molecular Formula | C17H13N3O4 |
| Molecular Weight | 323.31 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | 5-[(2-methyl-1H-indol-3-yl)diazenyl]benzene-1,3-dicarboxylic acid |
| SMILES | Cc1[nH]c2ccccc2c1/N=N/c1cc(C(=O)O)cc(C(=O)O)c1 |
| InChI | InChI=1S/C17H13N3O4/c1-9-15(13-4-2-3-5-14(13)18-9)20-19-12-7-10(16(21)22)6-11(8-12)17(23)24/h2-8,18H,1H3,(H,21,22)(H,23,24)/b20-19+ |
| InChIKey | HYTLUKJIYJEYLQ-FMQUCBEESA-N |
| XLogP | 4.29 |
| TPSA | 115.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.31 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 5-[(2-methyl-1H-indol-3-yl)diazenyl]benzene-1,3-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2-methyl-1H-indol-3-yl)diazenyl]benzene-1,3-dicarboxylic acid?
The IUPAC name of 5-[(2-methyl-1H-indol-3-yl)diazenyl]benzene-1,3-dicarboxylic acid (CID 3495525) is 5-[(2-methyl-1H-indol-3-yl)diazenyl]benzene-1,3-dicarboxylic acid.
What is the SMILES notation for 5-[(2-methyl-1H-indol-3-yl)diazenyl]benzene-1,3-dicarboxylic acid?
The canonical SMILES for 5-[(2-methyl-1H-indol-3-yl)diazenyl]benzene-1,3-dicarboxylic acid is Cc1[nH]c2ccccc2c1/N=N/c1cc(C(=O)O)cc(C(=O)O)c1.
What is the InChIKey of 5-[(2-methyl-1H-indol-3-yl)diazenyl]benzene-1,3-dicarboxylic acid?
The InChIKey is HYTLUKJIYJEYLQ-FMQUCBEESA-N. The full InChI is InChI=1S/C17H13N3O4/c1-9-15(13-4-2-3-5-14(13)18-9)20-19-12-7-10(16(21)22)6-11(8-12)17(23)24/h2-8,18H,1H3,(H,21,22)(H,23,24)/b20-19+.
What are the key properties of 5-[(2-methyl-1H-indol-3-yl)diazenyl]benzene-1,3-dicarboxylic acid?
5-[(2-methyl-1H-indol-3-yl)diazenyl]benzene-1,3-dicarboxylic acid has a molecular weight of 323.31 g/mol, XLogP of 4.29, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2-methyl-1H-indol-3-yl)diazenyl]benzene-1,3-dicarboxylic acid is sourced from PubChem (CID 3495525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).