C13H16N2O2 — CID 34958124
(2E,4E)-N-(2-ethoxy-3-pyridinyl)hexa-2,4-dienamide (PubChem CID 34958124) has the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. Its IUPAC name is (2E,4E)-N-(2-ethoxy-3-pyridinyl)hexa-2,4-dienamide.
| Compound Name | (2E,4E)-N-(2-ethoxy-3-pyridinyl)hexa-2,4-dienamide |
|---|---|
| PubChem CID | 34958124 |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | (2E,4E)-N-(2-ethoxy-3-pyridinyl)hexa-2,4-dienamide |
| SMILES | C/C=C/C=C/C(=O)Nc1cccnc1OCC |
| InChI | InChI=1S/C13H16N2O2/c1-3-5-6-9-12(16)15-11-8-7-10-14-13(11)17-4-2/h3,5-10H,4H2,1-2H3,(H,15,16)/b5-3+,9-6+ |
| InChIKey | ZTRDWRRJKPFPAU-USXIXMCRSA-N |
| XLogP | 2.55 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|