About 2-(1,3-dioxoisoindol-2-yl)ethyl 2-[(4-methylphenyl)sulfonylamino]acetate
2-(1,3-dioxoisoindol-2-yl)ethyl 2-[(4-methylphenyl)sulfonylamino]acetate (PubChem CID 3496324) has the molecular formula C19H18N2O6S
and a molecular weight of 402.43 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)ethyl 2-[(4-methylphenyl)sulfonylamino]acetate.
Molecular Properties
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)ethyl 2-[(4-methylphenyl)sulfonylamino]acetate |
| PubChem CID | 3496324 |
| Molecular Formula | C19H18N2O6S |
| Molecular Weight | 402.43 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)ethyl 2-[(4-methylphenyl)sulfonylamino]acetate |
| SMILES | Cc1ccc(S(=O)(=O)NCC(=O)OCCN2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C19H18N2O6S/c1-13-6-8-14(9-7-13)28(25,26)20-12-17(22)27-11-10-21-18(23)15-4-2-3-5-16(15)19(21)24/h2-9,20H,10-12H2,1H3 |
| InChIKey | ZLPWCSDBXBUXDU-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.43 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,3-dioxoisoindol-2-yl)ethyl 2-[(4-methylphenyl)sulfonylamino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-dioxoisoindol-2-yl)ethyl 2-[(4-methylphenyl)sulfonylamino]acetate?
The IUPAC name of 2-(1,3-dioxoisoindol-2-yl)ethyl 2-[(4-methylphenyl)sulfonylamino]acetate (CID 3496324) is 2-(1,3-dioxoisoindol-2-yl)ethyl 2-[(4-methylphenyl)sulfonylamino]acetate.
What is the SMILES notation for 2-(1,3-dioxoisoindol-2-yl)ethyl 2-[(4-methylphenyl)sulfonylamino]acetate?
The canonical SMILES for 2-(1,3-dioxoisoindol-2-yl)ethyl 2-[(4-methylphenyl)sulfonylamino]acetate is Cc1ccc(S(=O)(=O)NCC(=O)OCCN2C(=O)c3ccccc3C2=O)cc1.
What is the InChIKey of 2-(1,3-dioxoisoindol-2-yl)ethyl 2-[(4-methylphenyl)sulfonylamino]acetate?
The InChIKey is ZLPWCSDBXBUXDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N2O6S/c1-13-6-8-14(9-7-13)28(25,26)20-12-17(22)27-11-10-21-18(23)15-4-2-3-5-16(15)19(21)24/h2-9,20H,10-12H2,1H3.
What are the key properties of 2-(1,3-dioxoisoindol-2-yl)ethyl 2-[(4-methylphenyl)sulfonylamino]acetate?
2-(1,3-dioxoisoindol-2-yl)ethyl 2-[(4-methylphenyl)sulfonylamino]acetate has a molecular weight of 402.43 g/mol, XLogP of 1.11, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-dioxoisoindol-2-yl)ethyl 2-[(4-methylphenyl)sulfonylamino]acetate is sourced from PubChem (CID 3496324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).