C22H28N2O4 — CID 3496694
3-[4-(6,6-Dimethyl-4-oxo-5,7-dihydro-2,1-benzoxazol-3-yl)butyl]-6,6-dimethyl-5,7-dihydro-2,1-benzoxazol-4-one (PubChem CID 3496694) has the molecular formula C22H28N2O4 and a molecular weight of 384.50 g/mol. Its IUPAC name is 3-[4-(6,6-dimethyl-4-oxo-5,7-dihydro-2,1-benzoxazol-3-yl)butyl]-6,6-dimethyl-5,7-dihydro-2,1-benzoxazol-4-one.
| Compound Name | 3-[4-(6,6-Dimethyl-4-oxo-5,7-dihydro-2,1-benzoxazol-3-yl)butyl]-6,6-dimethyl-5,7-dihydro-2,1-benzoxazol-4-one |
|---|---|
| PubChem CID | 3496694 |
| Molecular Formula | C22H28N2O4 |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | 3-[4-(6,6-dimethyl-4-oxo-5,7-dihydro-2,1-benzoxazol-3-yl)butyl]-6,6-dimethyl-5,7-dihydro-2,1-benzoxazol-4-one |
| SMILES | CC1(CC2=NOC(=C2C(=O)C1)CCCCC3=C4C(=NO3)CC(CC4=O)(C)C)C |
| InChI | InChI=1S/C22H28N2O4/c1-21(2)9-13-19(15(25)11-21)17(27-23-13)7-5-6-8-18-20-14(24-28-18)10-22(3,4)12-16(20)26/h5-12H2,1-4H3 |
| InChIKey | QZDVSUZAXXNUQI-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 86.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | 578 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|