About 2-ethylhexanehydrazide
2-ethylhexanehydrazide (PubChem CID 3496881) has the molecular formula C8H18N2O
and a molecular weight of 158.25 g/mol. Its IUPAC name is 2-ethylhexanehydrazide.
Molecular Properties
| Compound Name | 2-ethylhexanehydrazide |
| PubChem CID | 3496881 |
| Molecular Formula | C8H18N2O |
| Molecular Weight | 158.25 g/mol |
| Exact Mass | 158.14 |
| IUPAC Name | 2-ethylhexanehydrazide |
| SMILES | CCCCC(CC)C(=O)NN |
| InChI | InChI=1S/C8H18N2O/c1-3-5-6-7(4-2)8(11)10-9/h7H,3-6,9H2,1-2H3,(H,10,11) |
| InChIKey | WOTFFLFEMKUWOF-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.25 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-ethylhexanehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylhexanehydrazide?
The IUPAC name of 2-ethylhexanehydrazide (CID 3496881) is 2-ethylhexanehydrazide.
What is the SMILES notation for 2-ethylhexanehydrazide?
The canonical SMILES for 2-ethylhexanehydrazide is CCCCC(CC)C(=O)NN.
What is the InChIKey of 2-ethylhexanehydrazide?
The InChIKey is WOTFFLFEMKUWOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N2O/c1-3-5-6-7(4-2)8(11)10-9/h7H,3-6,9H2,1-2H3,(H,10,11).
What are the key properties of 2-ethylhexanehydrazide?
2-ethylhexanehydrazide has a molecular weight of 158.25 g/mol, XLogP of 1.19, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylhexanehydrazide is sourced from PubChem (CID 3496881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).