C31H28N2O5S — CID 3497479
4-[hydroxy-(4-propoxyphenyl)methylidene]-1-(6-methyl-1,3-benzothiazol-2-yl)-5-(4-prop-2-enoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 3497479) has the molecular formula C31H28N2O5S and a molecular weight of 540.64 g/mol. Its IUPAC name is 4-[hydroxy-(4-propoxyphenyl)methylidene]-1-(6-methyl-1,3-benzothiazol-2-yl)-5-(4-prop-2-enoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | 4-[hydroxy-(4-propoxyphenyl)methylidene]-1-(6-methyl-1,3-benzothiazol-2-yl)-5-(4-prop-2-enoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 3497479 |
| Molecular Formula | C31H28N2O5S |
| Molecular Weight | 540.64 g/mol |
| Exact Mass | 540.17 |
| IUPAC Name | 4-[hydroxy-(4-propoxyphenyl)methylidene]-1-(6-methyl-1,3-benzothiazol-2-yl)-5-(4-prop-2-enoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | C=CCOc1ccc(C2C(=C(O)c3ccc(OCCC)cc3)C(=O)C(=O)N2c2nc3ccc(C)cc3s2)cc1 |
| InChI | InChI=1S/C31H28N2O5S/c1-4-16-37-22-11-7-20(8-12-22)27-26(28(34)21-9-13-23(14-10-21)38-17-5-2)29(35)30(36)33(27)31-32-24-15-6-19(3)18-25(24)39-31/h4,6-15,18,27,34H,1,5,16-17H2,2-3H3 |
| InChIKey | IUBULZPVQUTKOH-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.64 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|