C18H21ClN4OS — CID 34978527
(3S)-N-[2-(4-chlorophenyl)sulfanylethyl]-1-pyrimidin-2-ylpiperidine-3-carboxamide (PubChem CID 34978527) has the molecular formula C18H21ClN4OS and a molecular weight of 376.91 g/mol. Its IUPAC name is (3S)-N-[2-(4-chlorophenyl)sulfanylethyl]-1-pyrimidin-2-ylpiperidine-3-carboxamide.
| Compound Name | (3S)-N-[2-(4-chlorophenyl)sulfanylethyl]-1-pyrimidin-2-ylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 34978527 |
| Molecular Formula | C18H21ClN4OS |
| Molecular Weight | 376.91 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | (3S)-N-[2-(4-chlorophenyl)sulfanylethyl]-1-pyrimidin-2-ylpiperidine-3-carboxamide |
| SMILES | O=C(NCCSc1ccc(Cl)cc1)[C@H]1CCCN(c2ncccn2)C1 |
| InChI | InChI=1S/C18H21ClN4OS/c19-15-4-6-16(7-5-15)25-12-10-20-17(24)14-3-1-11-23(13-14)18-21-8-2-9-22-18/h2,4-9,14H,1,3,10-13H2,(H,20,24)/t14-/m0/s1 |
| InChIKey | WZLIXWLXRAHTBA-AWEZNQCLSA-N |
| XLogP | 3.25 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.91 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|