C25H18ClN3O6 — CID 3497870
N-[4-[3-[(4-chlorophenyl)-hydroxymethylidene]-2-(2-nitrophenyl)-4,5-dioxopyrrolidin-1-yl]phenyl]acetamide (PubChem CID 3497870) has the molecular formula C25H18ClN3O6 and a molecular weight of 491.89 g/mol. Its IUPAC name is N-[4-[3-[(4-chlorophenyl)-hydroxymethylidene]-2-(2-nitrophenyl)-4,5-dioxopyrrolidin-1-yl]phenyl]acetamide.
| Compound Name | N-[4-[3-[(4-chlorophenyl)-hydroxymethylidene]-2-(2-nitrophenyl)-4,5-dioxopyrrolidin-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 3497870 |
| Molecular Formula | C25H18ClN3O6 |
| Molecular Weight | 491.89 g/mol |
| Exact Mass | 491.09 |
| IUPAC Name | N-[4-[3-[(4-chlorophenyl)-hydroxymethylidene]-2-(2-nitrophenyl)-4,5-dioxopyrrolidin-1-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(N2C(=O)C(=O)C(=C(O)c3ccc(Cl)cc3)C2c2ccccc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C25H18ClN3O6/c1-14(30)27-17-10-12-18(13-11-17)28-22(19-4-2-3-5-20(19)29(34)35)21(24(32)25(28)33)23(31)15-6-8-16(26)9-7-15/h2-13,22,31H,1H3,(H,27,30) |
| InChIKey | RVBMHYDVZTXGQJ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 129.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.89 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|