C9H19N2O- — CID 3498288
2,2,6,6-tetramethyl-1-oxidopiperidin-4-amine (PubChem CID 3498288) has the molecular formula C9H19N2O- and a molecular weight of 171.26 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-1-oxidopiperidin-4-amine.
| Compound Name | 2,2,6,6-tetramethyl-1-oxidopiperidin-4-amine |
|---|---|
| PubChem CID | 3498288 |
| Molecular Formula | C9H19N2O- |
| Molecular Weight | 171.26 g/mol |
| Exact Mass | 171.15 |
| IUPAC Name | 2,2,6,6-tetramethyl-1-oxidopiperidin-4-amine |
| SMILES | CC1(C)CC(N)CC(C)(C)N1[O-] |
| InChI | InChI=1S/C9H19N2O/c1-8(2)5-7(10)6-9(3,4)11(8)12/h7H,5-6,10H2,1-4H3/q-1 |
| InChIKey | RJXZKBIIOCNSSQ-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.26 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |