C20H31N3O2 — CID 34983496
N-(2,3-dimethylphenyl)-2-[4-(2-ethylbutanoyl)piperazin-1-yl]acetamide (PubChem CID 34983496) has the molecular formula C20H31N3O2 and a molecular weight of 345.49 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-2-[4-(2-ethylbutanoyl)piperazin-1-yl]acetamide.
| Compound Name | N-(2,3-dimethylphenyl)-2-[4-(2-ethylbutanoyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 34983496 |
| Molecular Formula | C20H31N3O2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.24 |
| IUPAC Name | N-(2,3-dimethylphenyl)-2-[4-(2-ethylbutanoyl)piperazin-1-yl]acetamide |
| SMILES | CCC(CC)C(=O)N1CCN(CC(=O)Nc2cccc(C)c2C)CC1 |
| InChI | InChI=1S/C20H31N3O2/c1-5-17(6-2)20(25)23-12-10-22(11-13-23)14-19(24)21-18-9-7-8-15(3)16(18)4/h7-9,17H,5-6,10-14H2,1-4H3,(H,21,24) |
| InChIKey | GPVGGOTXVYBBQS-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |