[2-(2-methylpropoxycarbonyl)phenyl] pyridine-4-carboxylate

C17H17NO4 — CID 3498796

IUPAC[2-(2-methylpropoxycarbonyl)phenyl] pyridine-4-carboxylate
SMILESCC(C)COC(=O)c1ccccc1OC(=O)c1ccncc1
InChIInChI=1S/C17H17NO4/c1-12(2)11-21-17(20)14-5-3-4-6-15(14)22-16(19)13-7-9-18-10-8-13/h3-10,12H,11H2,1-2H3
InChIKeyGOPARTHBFWEFIU-UHFFFAOYSA-N
MW299.33 g/mol
LogP3.11
Rot. Bonds5

About [2-(2-methylpropoxycarbonyl)phenyl] pyridine-4-carboxylate

[2-(2-methylpropoxycarbonyl)phenyl] pyridine-4-carboxylate (PubChem CID 3498796) has the molecular formula C17H17NO4 and a molecular weight of 299.33 g/mol. Its IUPAC name is [2-(2-methylpropoxycarbonyl)phenyl] pyridine-4-carboxylate.

Molecular Properties

Compound Name[2-(2-methylpropoxycarbonyl)phenyl] pyridine-4-carboxylate
PubChem CID3498796
Molecular FormulaC17H17NO4
Molecular Weight299.33 g/mol
Exact Mass299.12
IUPAC Name[2-(2-methylpropoxycarbonyl)phenyl] pyridine-4-carboxylate
SMILESCC(C)COC(=O)c1ccccc1OC(=O)c1ccncc1
InChIInChI=1S/C17H17NO4/c1-12(2)11-21-17(20)14-5-3-4-6-15(14)22-16(19)13-7-9-18-10-8-13/h3-10,12H,11H2,1-2H3
InChIKeyGOPARTHBFWEFIU-UHFFFAOYSA-N
XLogP3.11
TPSA65.49 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500299.33
LogP ≤ 53.11
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phenol_ester', 'substructure': 'N/A'}

Analyze [2-(2-methylpropoxycarbonyl)phenyl] pyridine-4-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [2-(2-methylpropoxycarbonyl)phenyl] pyridine-4-carboxylate?
The IUPAC name of [2-(2-methylpropoxycarbonyl)phenyl] pyridine-4-carboxylate (CID 3498796) is [2-(2-methylpropoxycarbonyl)phenyl] pyridine-4-carboxylate.
What is the SMILES notation for [2-(2-methylpropoxycarbonyl)phenyl] pyridine-4-carboxylate?
The canonical SMILES for [2-(2-methylpropoxycarbonyl)phenyl] pyridine-4-carboxylate is CC(C)COC(=O)c1ccccc1OC(=O)c1ccncc1.
What is the InChIKey of [2-(2-methylpropoxycarbonyl)phenyl] pyridine-4-carboxylate?
The InChIKey is GOPARTHBFWEFIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17NO4/c1-12(2)11-21-17(20)14-5-3-4-6-15(14)22-16(19)13-7-9-18-10-8-13/h3-10,12H,11H2,1-2H3.
What are the key properties of [2-(2-methylpropoxycarbonyl)phenyl] pyridine-4-carboxylate?
[2-(2-methylpropoxycarbonyl)phenyl] pyridine-4-carboxylate has a molecular weight of 299.33 g/mol, XLogP of 3.11, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2-methylpropoxycarbonyl)phenyl] pyridine-4-carboxylate is sourced from PubChem (CID 3498796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).