C20H20FN3O4 — CID 3498845
ethyl 4-[3-[(2-fluorobenzoyl)hydrazinylidene]butanoylamino]benzoate (PubChem CID 3498845) has the molecular formula C20H20FN3O4 and a molecular weight of 385.40 g/mol. Its IUPAC name is ethyl 4-[3-[(2-fluorobenzoyl)hydrazinylidene]butanoylamino]benzoate.
| Compound Name | ethyl 4-[3-[(2-fluorobenzoyl)hydrazinylidene]butanoylamino]benzoate |
|---|---|
| PubChem CID | 3498845 |
| Molecular Formula | C20H20FN3O4 |
| Molecular Weight | 385.40 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | ethyl 4-[3-[(2-fluorobenzoyl)hydrazinylidene]butanoylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)CC(C)=NNC(=O)c2ccccc2F)cc1 |
| InChI | InChI=1S/C20H20FN3O4/c1-3-28-20(27)14-8-10-15(11-9-14)22-18(25)12-13(2)23-24-19(26)16-6-4-5-7-17(16)21/h4-11H,3,12H2,1-2H3,(H,22,25)(H,24,26) |
| InChIKey | NBKDOARLZXXGNH-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.40 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|