About [3-methyl-4-(4-methylphenyl)sulfonyl-1-phenylpyrazol-5-yl] 2-(3,4-dimethoxyphenyl)acetate
[3-methyl-4-(4-methylphenyl)sulfonyl-1-phenylpyrazol-5-yl] 2-(3,4-dimethoxyphenyl)acetate (PubChem CID 3499110) has the molecular formula C27H26N2O6S
and a molecular weight of 506.58 g/mol. Its IUPAC name is [3-methyl-4-(4-methylphenyl)sulfonyl-1-phenylpyrazol-5-yl] 2-(3,4-dimethoxyphenyl)acetate.
Molecular Properties
| Compound Name | [3-methyl-4-(4-methylphenyl)sulfonyl-1-phenylpyrazol-5-yl] 2-(3,4-dimethoxyphenyl)acetate |
| PubChem CID | 3499110 |
| Molecular Formula | C27H26N2O6S |
| Molecular Weight | 506.58 g/mol |
| Exact Mass | 506.15 |
| IUPAC Name | [3-methyl-4-(4-methylphenyl)sulfonyl-1-phenylpyrazol-5-yl] 2-(3,4-dimethoxyphenyl)acetate |
| SMILES | COc1ccc(CC(=O)Oc2c(S(=O)(=O)c3ccc(C)cc3)c(C)nn2-c2ccccc2)cc1OC |
| InChI | InChI=1S/C27H26N2O6S/c1-18-10-13-22(14-11-18)36(31,32)26-19(2)28-29(21-8-6-5-7-9-21)27(26)35-25(30)17-20-12-15-23(33-3)24(16-20)34-4/h5-16H,17H2,1-4H3 |
| InChIKey | VOJXDFIASYLOAV-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 96.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 506.58 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze [3-methyl-4-(4-methylphenyl)sulfonyl-1-phenylpyrazol-5-yl] 2-(3,4-dimethoxyphenyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-methyl-4-(4-methylphenyl)sulfonyl-1-phenylpyrazol-5-yl] 2-(3,4-dimethoxyphenyl)acetate?
The IUPAC name of [3-methyl-4-(4-methylphenyl)sulfonyl-1-phenylpyrazol-5-yl] 2-(3,4-dimethoxyphenyl)acetate (CID 3499110) is [3-methyl-4-(4-methylphenyl)sulfonyl-1-phenylpyrazol-5-yl] 2-(3,4-dimethoxyphenyl)acetate.
What is the SMILES notation for [3-methyl-4-(4-methylphenyl)sulfonyl-1-phenylpyrazol-5-yl] 2-(3,4-dimethoxyphenyl)acetate?
The canonical SMILES for [3-methyl-4-(4-methylphenyl)sulfonyl-1-phenylpyrazol-5-yl] 2-(3,4-dimethoxyphenyl)acetate is COc1ccc(CC(=O)Oc2c(S(=O)(=O)c3ccc(C)cc3)c(C)nn2-c2ccccc2)cc1OC.
What is the InChIKey of [3-methyl-4-(4-methylphenyl)sulfonyl-1-phenylpyrazol-5-yl] 2-(3,4-dimethoxyphenyl)acetate?
The InChIKey is VOJXDFIASYLOAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H26N2O6S/c1-18-10-13-22(14-11-18)36(31,32)26-19(2)28-29(21-8-6-5-7-9-21)27(26)35-25(30)17-20-12-15-23(33-3)24(16-20)34-4/h5-16H,17H2,1-4H3.
What are the key properties of [3-methyl-4-(4-methylphenyl)sulfonyl-1-phenylpyrazol-5-yl] 2-(3,4-dimethoxyphenyl)acetate?
[3-methyl-4-(4-methylphenyl)sulfonyl-1-phenylpyrazol-5-yl] 2-(3,4-dimethoxyphenyl)acetate has a molecular weight of 506.58 g/mol, XLogP of 4.49, 8 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [3-methyl-4-(4-methylphenyl)sulfonyl-1-phenylpyrazol-5-yl] 2-(3,4-dimethoxyphenyl)acetate is sourced from PubChem (CID 3499110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).