C24H28N2O2S — CID 3499289
5',6,6-trimethyl-4'-phenyl-2-prop-2-enylsulfanylspiro[1,5-dihydropyrimidine-4,2'-3,4-dihydrochromene]-7'-ol (PubChem CID 3499289) has the molecular formula C24H28N2O2S and a molecular weight of 408.57 g/mol. Its IUPAC name is 5',6,6-trimethyl-4'-phenyl-2-prop-2-enylsulfanylspiro[1,5-dihydropyrimidine-4,2'-3,4-dihydrochromene]-7'-ol.
| Compound Name | 5',6,6-trimethyl-4'-phenyl-2-prop-2-enylsulfanylspiro[1,5-dihydropyrimidine-4,2'-3,4-dihydrochromene]-7'-ol |
|---|---|
| PubChem CID | 3499289 |
| Molecular Formula | C24H28N2O2S |
| Molecular Weight | 408.57 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | 5',6,6-trimethyl-4'-phenyl-2-prop-2-enylsulfanylspiro[1,5-dihydropyrimidine-4,2'-3,4-dihydrochromene]-7'-ol |
| SMILES | C=CCSC1=NC2(CC(c3ccccc3)c3c(C)cc(O)cc3O2)CC(C)(C)N1 |
| InChI | InChI=1S/C24H28N2O2S/c1-5-11-29-22-25-23(3,4)15-24(26-22)14-19(17-9-7-6-8-10-17)21-16(2)12-18(27)13-20(21)28-24/h5-10,12-13,19,27H,1,11,14-15H2,2-4H3,(H,25,26) |
| InChIKey | UPCQMQBWSIQPAJ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.57 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|