About 3-(4-methoxyphenyl)-N-(1,2,4-triazol-4-yl)propanamide
3-(4-methoxyphenyl)-N-(1,2,4-triazol-4-yl)propanamide (PubChem CID 3499311) has the molecular formula C12H14N4O2
and a molecular weight of 246.27 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-N-(1,2,4-triazol-4-yl)propanamide.
Molecular Properties
| Compound Name | 3-(4-methoxyphenyl)-N-(1,2,4-triazol-4-yl)propanamide |
| PubChem CID | 3499311 |
| Molecular Formula | C12H14N4O2 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | 3-(4-methoxyphenyl)-N-(1,2,4-triazol-4-yl)propanamide |
| SMILES | COc1ccc(CCC(=O)Nn2cnnc2)cc1 |
| InChI | InChI=1S/C12H14N4O2/c1-18-11-5-2-10(3-6-11)4-7-12(17)15-16-8-13-14-9-16/h2-3,5-6,8-9H,4,7H2,1H3,(H,15,17) |
| InChIKey | DKEYMLOSJMPVPF-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(4-methoxyphenyl)-N-(1,2,4-triazol-4-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-methoxyphenyl)-N-(1,2,4-triazol-4-yl)propanamide?
The IUPAC name of 3-(4-methoxyphenyl)-N-(1,2,4-triazol-4-yl)propanamide (CID 3499311) is 3-(4-methoxyphenyl)-N-(1,2,4-triazol-4-yl)propanamide.
What is the SMILES notation for 3-(4-methoxyphenyl)-N-(1,2,4-triazol-4-yl)propanamide?
The canonical SMILES for 3-(4-methoxyphenyl)-N-(1,2,4-triazol-4-yl)propanamide is COc1ccc(CCC(=O)Nn2cnnc2)cc1.
What is the InChIKey of 3-(4-methoxyphenyl)-N-(1,2,4-triazol-4-yl)propanamide?
The InChIKey is DKEYMLOSJMPVPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N4O2/c1-18-11-5-2-10(3-6-11)4-7-12(17)15-16-8-13-14-9-16/h2-3,5-6,8-9H,4,7H2,1H3,(H,15,17).
What are the key properties of 3-(4-methoxyphenyl)-N-(1,2,4-triazol-4-yl)propanamide?
3-(4-methoxyphenyl)-N-(1,2,4-triazol-4-yl)propanamide has a molecular weight of 246.27 g/mol, XLogP of 0.99, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-methoxyphenyl)-N-(1,2,4-triazol-4-yl)propanamide is sourced from PubChem (CID 3499311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).