C24H23FN8O2 — CID 3499784
6-fluoro-2-[5-nitro-6-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-4-yl]-1,3,4,5-tetrahydropyrido[4,3-b]indole (PubChem CID 3499784) has the molecular formula C24H23FN8O2 and a molecular weight of 474.50 g/mol. Its IUPAC name is 6-fluoro-2-[5-nitro-6-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-4-yl]-1,3,4,5-tetrahydropyrido[4,3-b]indole.
| Compound Name | 6-fluoro-2-[5-nitro-6-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-4-yl]-1,3,4,5-tetrahydropyrido[4,3-b]indole |
|---|---|
| PubChem CID | 3499784 |
| Molecular Formula | C24H23FN8O2 |
| Molecular Weight | 474.50 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | 6-fluoro-2-[5-nitro-6-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-4-yl]-1,3,4,5-tetrahydropyrido[4,3-b]indole |
| SMILES | O=[N+]([O-])c1c(N2CCN(c3ccccn3)CC2)ncnc1N1CCc2[nH]c3c(F)cccc3c2C1 |
| InChI | InChI=1S/C24H23FN8O2/c25-18-5-3-4-16-17-14-32(9-7-19(17)29-21(16)18)24-22(33(34)35)23(27-15-28-24)31-12-10-30(11-13-31)20-6-1-2-8-26-20/h1-6,8,15,29H,7,9-14H2 |
| InChIKey | ZOYVTGXFTFXPIY-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 107.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.50 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|