About 1,3-benzothiazine-2,4-dione
1,3-benzothiazine-2,4-dione (PubChem CID 3499793) has the molecular formula C8H5NO2S
and a molecular weight of 179.20 g/mol. Its IUPAC name is 1,3-benzothiazine-2,4-dione.
Molecular Properties
| Compound Name | 1,3-benzothiazine-2,4-dione |
| PubChem CID | 3499793 |
| Molecular Formula | C8H5NO2S |
| Molecular Weight | 179.20 g/mol |
| Exact Mass | 179.00 |
| IUPAC Name | 1,3-benzothiazine-2,4-dione |
| SMILES | O=c1[nH]c(=O)c2ccccc2s1 |
| InChI | InChI=1S/C8H5NO2S/c10-7-5-3-1-2-4-6(5)12-8(11)9-7/h1-4H,(H,9,10,11) |
| InChIKey | IZQGCATXOBZJQL-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.20 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,3-benzothiazine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-benzothiazine-2,4-dione?
The IUPAC name of 1,3-benzothiazine-2,4-dione (CID 3499793) is 1,3-benzothiazine-2,4-dione.
What is the SMILES notation for 1,3-benzothiazine-2,4-dione?
The canonical SMILES for 1,3-benzothiazine-2,4-dione is O=c1[nH]c(=O)c2ccccc2s1.
What is the InChIKey of 1,3-benzothiazine-2,4-dione?
The InChIKey is IZQGCATXOBZJQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5NO2S/c10-7-5-3-1-2-4-6(5)12-8(11)9-7/h1-4H,(H,9,10,11).
What are the key properties of 1,3-benzothiazine-2,4-dione?
1,3-benzothiazine-2,4-dione has a molecular weight of 179.20 g/mol, XLogP of 0.95, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-benzothiazine-2,4-dione is sourced from PubChem (CID 3499793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).