About 2-ethyl-1-(2-methoxy-4,5-dimethylphenyl)sulfonylpiperidine
2-ethyl-1-(2-methoxy-4,5-dimethylphenyl)sulfonylpiperidine (PubChem CID 3499882) has the molecular formula C16H25NO3S
and a molecular weight of 311.45 g/mol. Its IUPAC name is 2-ethyl-1-(2-methoxy-4,5-dimethylphenyl)sulfonylpiperidine.
Molecular Properties
| Compound Name | 2-ethyl-1-(2-methoxy-4,5-dimethylphenyl)sulfonylpiperidine |
| PubChem CID | 3499882 |
| Molecular Formula | C16H25NO3S |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | 2-ethyl-1-(2-methoxy-4,5-dimethylphenyl)sulfonylpiperidine |
| SMILES | CCC1CCCCN1S(=O)(=O)c1cc(C)c(C)cc1OC |
| InChI | InChI=1S/C16H25NO3S/c1-5-14-8-6-7-9-17(14)21(18,19)16-11-13(3)12(2)10-15(16)20-4/h10-11,14H,5-9H2,1-4H3 |
| InChIKey | SEADQRGEASBLEQ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-ethyl-1-(2-methoxy-4,5-dimethylphenyl)sulfonylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-1-(2-methoxy-4,5-dimethylphenyl)sulfonylpiperidine?
The IUPAC name of 2-ethyl-1-(2-methoxy-4,5-dimethylphenyl)sulfonylpiperidine (CID 3499882) is 2-ethyl-1-(2-methoxy-4,5-dimethylphenyl)sulfonylpiperidine.
What is the SMILES notation for 2-ethyl-1-(2-methoxy-4,5-dimethylphenyl)sulfonylpiperidine?
The canonical SMILES for 2-ethyl-1-(2-methoxy-4,5-dimethylphenyl)sulfonylpiperidine is CCC1CCCCN1S(=O)(=O)c1cc(C)c(C)cc1OC.
What is the InChIKey of 2-ethyl-1-(2-methoxy-4,5-dimethylphenyl)sulfonylpiperidine?
The InChIKey is SEADQRGEASBLEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25NO3S/c1-5-14-8-6-7-9-17(14)21(18,19)16-11-13(3)12(2)10-15(16)20-4/h10-11,14H,5-9H2,1-4H3.
What are the key properties of 2-ethyl-1-(2-methoxy-4,5-dimethylphenyl)sulfonylpiperidine?
2-ethyl-1-(2-methoxy-4,5-dimethylphenyl)sulfonylpiperidine has a molecular weight of 311.45 g/mol, XLogP of 3.27, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-1-(2-methoxy-4,5-dimethylphenyl)sulfonylpiperidine is sourced from PubChem (CID 3499882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).