C28H19N3O6 — CID 3500672
5-(1,3-dioxoisoindol-2-yl)-1-N,3-N-bis(2-hydroxyphenyl)benzene-1,3-dicarboxamide (PubChem CID 3500672) has the molecular formula C28H19N3O6 and a molecular weight of 493.48 g/mol. Its IUPAC name is 5-(1,3-dioxoisoindol-2-yl)-1-N,3-N-bis(2-hydroxyphenyl)benzene-1,3-dicarboxamide.
| Compound Name | 5-(1,3-dioxoisoindol-2-yl)-1-N,3-N-bis(2-hydroxyphenyl)benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 3500672 |
| Molecular Formula | C28H19N3O6 |
| Molecular Weight | 493.48 g/mol |
| Exact Mass | 493.13 |
| IUPAC Name | 5-(1,3-dioxoisoindol-2-yl)-1-N,3-N-bis(2-hydroxyphenyl)benzene-1,3-dicarboxamide |
| SMILES | O=C(Nc1ccccc1O)c1cc(C(=O)Nc2ccccc2O)cc(N2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C28H19N3O6/c32-23-11-5-3-9-21(23)29-25(34)16-13-17(26(35)30-22-10-4-6-12-24(22)33)15-18(14-16)31-27(36)19-7-1-2-8-20(19)28(31)37/h1-15,32-33H,(H,29,34)(H,30,35) |
| InChIKey | XGZOQVHPFGOQRX-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 136.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.48 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|