About 7-chloro-2H-triazolo[4,5-c]pyridazine
7-chloro-2H-triazolo[4,5-c]pyridazine (PubChem CID 3500812) has the molecular formula C4H2ClN5
and a molecular weight of 155.55 g/mol. Its IUPAC name is 7-chloro-2H-triazolo[4,5-c]pyridazine.
Molecular Properties
| Compound Name | 7-chloro-2H-triazolo[4,5-c]pyridazine |
| PubChem CID | 3500812 |
| Molecular Formula | C4H2ClN5 |
| Molecular Weight | 155.55 g/mol |
| Exact Mass | 155.00 |
| IUPAC Name | 7-chloro-2H-triazolo[4,5-c]pyridazine |
| SMILES | Clc1cnnc2n[nH]nc12 |
| InChI | InChI=1S/C4H2ClN5/c5-2-1-6-8-4-3(2)7-10-9-4/h1H,(H,7,8,9,10) |
| InChIKey | NJYYLIDAZQAURY-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.55 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-chloro-2H-triazolo[4,5-c]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-2H-triazolo[4,5-c]pyridazine?
The IUPAC name of 7-chloro-2H-triazolo[4,5-c]pyridazine (CID 3500812) is 7-chloro-2H-triazolo[4,5-c]pyridazine.
What is the SMILES notation for 7-chloro-2H-triazolo[4,5-c]pyridazine?
The canonical SMILES for 7-chloro-2H-triazolo[4,5-c]pyridazine is Clc1cnnc2n[nH]nc12.
What is the InChIKey of 7-chloro-2H-triazolo[4,5-c]pyridazine?
The InChIKey is NJYYLIDAZQAURY-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H2ClN5/c5-2-1-6-8-4-3(2)7-10-9-4/h1H,(H,7,8,9,10).
What are the key properties of 7-chloro-2H-triazolo[4,5-c]pyridazine?
7-chloro-2H-triazolo[4,5-c]pyridazine has a molecular weight of 155.55 g/mol, XLogP of 0.40, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-2H-triazolo[4,5-c]pyridazine is sourced from PubChem (CID 3500812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).