C18H22F3N3O — CID 3500836
3-(2-ethoxyethyl)-1-[3-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydro-4H-pyrazolo[3,4-b]azepine (PubChem CID 3500836) has the molecular formula C18H22F3N3O and a molecular weight of 353.39 g/mol. Its IUPAC name is 3-(2-ethoxyethyl)-1-[3-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydro-4H-pyrazolo[3,4-b]azepine.
| Compound Name | 3-(2-ethoxyethyl)-1-[3-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydro-4H-pyrazolo[3,4-b]azepine |
|---|---|
| PubChem CID | 3500836 |
| Molecular Formula | C18H22F3N3O |
| Molecular Weight | 353.39 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | 3-(2-ethoxyethyl)-1-[3-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydro-4H-pyrazolo[3,4-b]azepine |
| SMILES | CCOCCc1nn(-c2cccc(C(F)(F)F)c2)c2c1CCCCN2 |
| InChI | InChI=1S/C18H22F3N3O/c1-2-25-11-9-16-15-8-3-4-10-22-17(15)24(23-16)14-7-5-6-13(12-14)18(19,20)21/h5-7,12,22H,2-4,8-11H2,1H3 |
| InChIKey | OECWYTYYKUEZLP-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.39 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|