C24H29N3O3 — CID 3500939
1-[3-[2-(diethylamino)ethoxy]phenyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylic acid (PubChem CID 3500939) has the molecular formula C24H29N3O3 and a molecular weight of 407.51 g/mol. Its IUPAC name is 1-[3-[2-(diethylamino)ethoxy]phenyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylic acid.
| Compound Name | 1-[3-[2-(diethylamino)ethoxy]phenyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylic acid |
|---|---|
| PubChem CID | 3500939 |
| Molecular Formula | C24H29N3O3 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | 1-[3-[2-(diethylamino)ethoxy]phenyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylic acid |
| SMILES | CCN(CC)CCOc1cccc(C2NC(C(=O)O)Cc3c2[nH]c2ccccc32)c1 |
| InChI | InChI=1S/C24H29N3O3/c1-3-27(4-2)12-13-30-17-9-7-8-16(14-17)22-23-19(15-21(26-22)24(28)29)18-10-5-6-11-20(18)25-23/h5-11,14,21-22,25-26H,3-4,12-13,15H2,1-2H3,(H,28,29) |
| InChIKey | SYYZWMLDTJBTRC-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 77.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|