C23H20N2O3 — CID 3500970
12-(3,4-dihydroxyphenyl)-3-methyl-8,9,10,12-tetrahydro-7H-benzo[b][4,7]phenanthrolin-11-one (PubChem CID 3500970) has the molecular formula C23H20N2O3 and a molecular weight of 372.42 g/mol. Its IUPAC name is 12-(3,4-dihydroxyphenyl)-3-methyl-8,9,10,12-tetrahydro-7H-benzo[b][4,7]phenanthrolin-11-one.
| Compound Name | 12-(3,4-dihydroxyphenyl)-3-methyl-8,9,10,12-tetrahydro-7H-benzo[b][4,7]phenanthrolin-11-one |
|---|---|
| PubChem CID | 3500970 |
| Molecular Formula | C23H20N2O3 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | 12-(3,4-dihydroxyphenyl)-3-methyl-8,9,10,12-tetrahydro-7H-benzo[b][4,7]phenanthrolin-11-one |
| SMILES | Cc1ccc2c3c(ccc2n1)NC1=C(C(=O)CCC1)C3c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C23H20N2O3/c1-12-5-7-14-15(24-12)8-9-17-22(14)21(13-6-10-18(26)20(28)11-13)23-16(25-17)3-2-4-19(23)27/h5-11,21,25-26,28H,2-4H2,1H3 |
| InChIKey | ZREQECYWWGBHBW-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|