C17H11BrFN5O2 — CID 3501728
7-(5-bromo-2-fluorophenyl)-5-(3-nitrophenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine (PubChem CID 3501728) has the molecular formula C17H11BrFN5O2 and a molecular weight of 416.21 g/mol. Its IUPAC name is 7-(5-bromo-2-fluorophenyl)-5-(3-nitrophenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine.
| Compound Name | 7-(5-bromo-2-fluorophenyl)-5-(3-nitrophenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 3501728 |
| Molecular Formula | C17H11BrFN5O2 |
| Molecular Weight | 416.21 g/mol |
| Exact Mass | 415.01 |
| IUPAC Name | 7-(5-bromo-2-fluorophenyl)-5-(3-nitrophenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine |
| SMILES | O=[N+]([O-])c1cccc(C2=CC(c3cc(Br)ccc3F)n3ncnc3N2)c1 |
| InChI | InChI=1S/C17H11BrFN5O2/c18-11-4-5-14(19)13(7-11)16-8-15(22-17-20-9-21-23(16)17)10-2-1-3-12(6-10)24(25)26/h1-9,16H,(H,20,21,22) |
| InChIKey | SHRIHTZTXSJPFE-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 85.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.21 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|