About 1-methyl-1-(3-methyl-1,1-dioxothiolan-3-yl)-3-prop-2-enylthiourea
1-methyl-1-(3-methyl-1,1-dioxothiolan-3-yl)-3-prop-2-enylthiourea (PubChem CID 3501839) has the molecular formula C10H18N2O2S2
and a molecular weight of 262.40 g/mol. Its IUPAC name is 1-methyl-1-(3-methyl-1,1-dioxothiolan-3-yl)-3-prop-2-enylthiourea.
Molecular Properties
| Compound Name | 1-methyl-1-(3-methyl-1,1-dioxothiolan-3-yl)-3-prop-2-enylthiourea |
| PubChem CID | 3501839 |
| Molecular Formula | C10H18N2O2S2 |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 1-methyl-1-(3-methyl-1,1-dioxothiolan-3-yl)-3-prop-2-enylthiourea |
| SMILES | C=CCNC(=S)N(C)C1(C)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H18N2O2S2/c1-4-6-11-9(15)12(3)10(2)5-7-16(13,14)8-10/h4H,1,5-8H2,2-3H3,(H,11,15) |
| InChIKey | AGQLEYPCSSNPLH-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-1-(3-methyl-1,1-dioxothiolan-3-yl)-3-prop-2-enylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-1-(3-methyl-1,1-dioxothiolan-3-yl)-3-prop-2-enylthiourea?
The IUPAC name of 1-methyl-1-(3-methyl-1,1-dioxothiolan-3-yl)-3-prop-2-enylthiourea (CID 3501839) is 1-methyl-1-(3-methyl-1,1-dioxothiolan-3-yl)-3-prop-2-enylthiourea.
What is the SMILES notation for 1-methyl-1-(3-methyl-1,1-dioxothiolan-3-yl)-3-prop-2-enylthiourea?
The canonical SMILES for 1-methyl-1-(3-methyl-1,1-dioxothiolan-3-yl)-3-prop-2-enylthiourea is C=CCNC(=S)N(C)C1(C)CCS(=O)(=O)C1.
What is the InChIKey of 1-methyl-1-(3-methyl-1,1-dioxothiolan-3-yl)-3-prop-2-enylthiourea?
The InChIKey is AGQLEYPCSSNPLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2O2S2/c1-4-6-11-9(15)12(3)10(2)5-7-16(13,14)8-10/h4H,1,5-8H2,2-3H3,(H,11,15).
What are the key properties of 1-methyl-1-(3-methyl-1,1-dioxothiolan-3-yl)-3-prop-2-enylthiourea?
1-methyl-1-(3-methyl-1,1-dioxothiolan-3-yl)-3-prop-2-enylthiourea has a molecular weight of 262.40 g/mol, XLogP of 0.56, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-1-(3-methyl-1,1-dioxothiolan-3-yl)-3-prop-2-enylthiourea is sourced from PubChem (CID 3501839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).