About N-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)acetamide
N-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)acetamide (PubChem CID 3502401) has the molecular formula C8H9N3OS
and a molecular weight of 195.25 g/mol. Its IUPAC name is N-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)acetamide.
Molecular Properties
| Compound Name | N-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)acetamide |
| PubChem CID | 3502401 |
| Molecular Formula | C8H9N3OS |
| Molecular Weight | 195.25 g/mol |
| Exact Mass | 195.05 |
| IUPAC Name | N-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)acetamide |
| SMILES | CC(=O)NCc1cn2ccsc2n1 |
| InChI | InChI=1S/C8H9N3OS/c1-6(12)9-4-7-5-11-2-3-13-8(11)10-7/h2-3,5H,4H2,1H3,(H,9,12) |
| InChIKey | RKJMULIVSIOSQW-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.25 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)acetamide?
The IUPAC name of N-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)acetamide (CID 3502401) is N-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)acetamide.
What is the SMILES notation for N-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)acetamide?
The canonical SMILES for N-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)acetamide is CC(=O)NCc1cn2ccsc2n1.
What is the InChIKey of N-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)acetamide?
The InChIKey is RKJMULIVSIOSQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3OS/c1-6(12)9-4-7-5-11-2-3-13-8(11)10-7/h2-3,5H,4H2,1H3,(H,9,12).
What are the key properties of N-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)acetamide?
N-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)acetamide has a molecular weight of 195.25 g/mol, XLogP of 1.03, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)acetamide is sourced from PubChem (CID 3502401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).